| product Name |
D(-)-Erythrose |
| Synonyms |
Erythrosesyrupwv; D-Erythrose; (2R,3R)-2,3,4-trihydroxybutanal; (3R,4R)-tetrahydrofuran-2,3,4-triol; (2S,3R)-2,3,4-trihydroxybutanal; (2R,3S)-2,3,4-trihydroxybutanal; (2R,3R,4R)-tetrahydrofuran-2,3,4-triol |
| Molecular Formula |
C4H8O4 |
| Molecular Weight |
120.1039 |
| InChI |
InChI=1/C4H8O4/c5-2-1-8-4(7)3(2)6/h2-7H,1H2/t2-,3-,4-/m1/s1 |
| CAS Registry Number |
583-50-6 |
| EINECS |
209-505-2 |
| Molecular Structure |
|
| Density |
1.698g/cm3 |
| Boiling point |
290.583°C at 760 mmHg |
| Refractive index |
1.619 |
| Flash point |
129.54°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
