| product Name |
Fenipentol |
| Synonyms |
.alpha.-Butylbenzenemethanol; .alpha.-Butylbenzyl alcohol; 1-Phenylpentan-1-ol; 583-03-9; a-Butylbenzyl Alcohol; Benzenemethanol, .alpha.-butyl-; benzenemethanol, alpha-butyl-; Benzyl alcohol, .alpha.-butyl-; Butyl hydroxy toluene |
| Molecular Formula |
C11H16O |
| Molecular Weight |
164.2441 |
| InChI |
InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
| CAS Registry Number |
583-03-9 |
| EINECS |
209-493-9 |
| Molecular Structure |
|
| Density |
0.965g/cm3 |
| Boiling point |
245.2°C at 760 mmHg |
| Refractive index |
1.514 |
| Flash point |
110.7°C |
| Vapour Pressur |
0.0156mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
