| product Name |
Beta-Methylphenethylamine |
| Synonyms |
1-Amino-2-phenylpropane; 2-Phenylpropylamine,99.9%; 2-Phenylpropylamine; 2-phenylpropan-1-amine; (2R)-2-phenylpropan-1-aminium; (2S)-2-phenylpropan-1-aminium |
| Molecular Formula |
C9H14N |
| Molecular Weight |
136.2136 |
| InChI |
InChI=1/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/p+1/t8-/m1/s1 |
| CAS Registry Number |
582-22-9 |
| EINECS |
209-479-2 |
| Molecular Structure |
|
| Boiling point |
210°C at 760 mmHg |
| Flash point |
84.6°C |
| Vapour Pressur |
0.197mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
