| product Name |
2-Nitronaphthalene |
| Synonyms |
2-Nitronaphthalene (purity) |
| Molecular Formula |
C10H7NO2 |
| Molecular Weight |
173.1681 |
| InChI |
InChI=1/C10H7NO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| CAS Registry Number |
581-89-5 |
| EINECS |
209-474-5 |
| Molecular Structure |
|
| Density |
1.279g/cm3 |
| Boiling point |
319.6°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
158.7°C |
| Vapour Pressur |
0.000628mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
 N:Dangerous for the environment;
|
| Risk Codes |
R45:May cause cancer.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Safety Description |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
