product Name |
1,6-Dimethylnaphthalene |
Synonyms |
AI3-17608; HSDB 6024; NSC 52966; Naphthalene, 1,6-dimethyl-; Naphthalene, 1,6-dimethyl- (8CI)(9CI) |
Molecular Formula |
C12H12 |
Molecular Weight |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-8H,1-2H3 |
CAS Registry Number |
575-43-9 |
EINECS |
209-385-1 |
Molecular Structure |
|
Density |
1g/cm3 |
Boiling point |
264.4°C at 760 mmHg |
Refractive index |
1.604 |
Flash point |
110.5°C |
Vapour Pressur |
0.0159mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|