product Name |
4-fluoro-1-naphthoic acid |
Synonyms |
4-Fluoro-1-naphthoic acid; 4-fluoronaphthalene-1-carboxylic acid; 4-fluoronaphthalene-1-carboxylate |
Molecular Formula |
C11H6FO2 |
Molecular Weight |
189.1631 |
InChI |
InChI=1/C11H7FO2/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6H,(H,13,14)/p-1 |
CAS Registry Number |
573-03-5 |
EINECS |
209-346-9 |
Molecular Structure |
|
Melting point |
223-227℃ |
Boiling point |
370.8°C at 760 mmHg |
Flash point |
178°C |
Vapour Pressur |
3.74E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|