| product Name |
2,4,6-Trimethoxybenzoic acid |
| Synonyms |
Benzoic acid, 2,4,6-trimethoxy- |
| Molecular Formula |
C10H12O5 |
| Molecular Weight |
212.1993 |
| InChI |
InChI=1/C10H12O5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3,(H,11,12) |
| CAS Registry Number |
570-02-5 |
| EINECS |
209-325-4 |
| Molecular Structure |
|
| Density |
1.219g/cm3 |
| Boiling point |
350.6°C at 760 mmHg |
| Refractive index |
1.523 |
| Flash point |
137.4°C |
| Vapour Pressur |
1.62E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|