product Name |
2,4,6-Trimethoxybenzoic acid |
Synonyms |
Benzoic acid, 2,4,6-trimethoxy- |
Molecular Formula |
C10H12O5 |
Molecular Weight |
212.1993 |
InChI |
InChI=1/C10H12O5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3,(H,11,12) |
CAS Registry Number |
570-02-5 |
EINECS |
209-325-4 |
Molecular Structure |
|
Density |
1.219g/cm3 |
Boiling point |
350.6°C at 760 mmHg |
Refractive index |
1.523 |
Flash point |
137.4°C |
Vapour Pressur |
1.62E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|