| product Name |
Purpurogallin |
| Molecular Formula |
C11H8O5 |
| Molecular Weight |
220.1782 |
| InChI |
InChI=1/C11H8O5/c12-6-3-1-2-5-4-7(13)10(15)11(16)8(5)9(6)14/h1-4,13,15-16H,(H,12,14) |
| CAS Registry Number |
569-77-7 |
| EINECS |
209-324-9 |
| Molecular Structure |
|
| Density |
1.74g/cm3 |
| Melting point |
275℃ |
| Boiling point |
357.9°C at 760 mmHg |
| Refractive index |
1.79 |
| Flash point |
184.5°C |
| Vapour Pressur |
1.46E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
