| product Name |
hexaphenylbenzene |
| Synonyms |
3',4',5',6'-Tetraphenyl-o-terphenyl; 1,2,3,4,5,6-hexaphenylbenzene |
| Molecular Formula |
C42H30 |
| Molecular Weight |
534.6876 |
| InChI |
InChI=1/C42H30/c1-7-19-31(20-8-1)37-38(32-21-9-2-10-22-32)40(34-25-13-4-14-26-34)42(36-29-17-6-18-30-36)41(35-27-15-5-16-28-35)39(37)33-23-11-3-12-24-33/h1-30H |
| CAS Registry Number |
992-04-1 |
| EINECS |
213-591-7 |
| Molecular Structure |
|
| Density |
1.111g/cm3 |
| Melting point |
300℃ |
| Boiling point |
534.8°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
284°C |
| Vapour Pressur |
5.64E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|