product Name |
Oxamic acid, sodium salt |
Synonyms |
oxamic acid sodium; Sodium oxamate; sodium amino(oxo)acetate; aminooxo-aceticacimonosodiumsalt |
Molecular Formula |
C2H2NNaO3 |
Molecular Weight |
111.0319 |
InChI |
InChI=1/C2H3NO3.Na/c3-1(4)2(5)6;/h(H2,3,4)(H,5,6);/q;+1/p-1 |
CAS Registry Number |
565-73-1 |
EINECS |
209-290-5 |
Molecular Structure |
|
Melting point |
300℃ |
Boiling point |
306.3°C at 760 mmHg |
Flash point |
139°C |
Vapour Pressur |
0.000177mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|