| product Name |
2-Bromopropene |
| Synonyms |
Bromopropene,90%; 2-Bromo-1-propene; Isopropenyl bromide; 2-bromoprop-1-ene |
| Molecular Formula |
C3H5Br |
| Molecular Weight |
120.9758 |
| InChI |
InChI=1/C3H5Br/c1-3(2)4/h1H2,2H3 |
| CAS Registry Number |
557-93-7 |
| EINECS |
209-185-4 |
| Molecular Structure |
|
| Density |
1.404g/cm3 |
| Boiling point |
48.4°C at 760 mmHg |
| Refractive index |
1.452 |
| Vapour Pressur |
324mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
