| product Name |
Pseudothiohydantoin |
| Synonyms |
2-imino-1,3-thiazol-4-one; 2-amino-1,3-thiazol-4(5H)-one |
| Molecular Formula |
C3H4N2OS |
| Molecular Weight |
116.1417 |
| InChI |
InChI=1/C3H4N2OS/c4-3-5-2(6)1-7-3/h1H2,(H2,4,5,6) |
| CAS Registry Number |
556-90-1 |
| EINECS |
209-145-6 |
| Molecular Structure |
|
| Density |
1.78g/cm3 |
| Melting point |
249℃ |
| Boiling point |
253.5°C at 760 mmHg |
| Refractive index |
1.785 |
| Flash point |
107.1°C |
| Vapour Pressur |
0.0182mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
