| product Name |
2-Coumaranone |
| Synonyms |
3H-Benzofuran-2-one; 2,3-Dihydrobenzofuran-2-one; 2,3-Dihydrobenzo[b]furan-2-one; Benzofuran-2(3H)-one; 2(3H)-Benzofuranone; Benzo-furanone; 1-benzofuran-2(3H)-one; Coumarone-2(3H)-ketone |
| Molecular Formula |
C8H6O2 |
| Molecular Weight |
134.132 |
| InChI |
InChI=1/C8H6O2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4H,5H2 |
| CAS Registry Number |
553-86-6 |
| EINECS |
209-052-0 |
| Molecular Structure |
|
| Density |
1.264g/cm3 |
| Melting point |
47-52℃ |
| Boiling point |
249°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
96.9°C |
| Vapour Pressur |
0.0235mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|