| product Name |
Furoin |
| Synonyms |
alpha-Furoin; 1,2-di(furan-2-yl)-2-hydroxyethanone; (2S)-1,2-di(furan-2-yl)-2-hydroxyethanone; (2R)-1,2-di(furan-2-yl)-2-hydroxyethanone |
| Molecular Formula |
C10H8O4 |
| Molecular Weight |
192.1681 |
| InChI |
InChI=1/C10H8O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9,11H/t9-/m1/s1 |
| CAS Registry Number |
552-86-3 |
| EINECS |
209-024-8 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Melting point |
134-137℃ |
| Boiling point |
306.8°C at 760 mmHg |
| Refractive index |
1.557 |
| Flash point |
139.4°C |
| Vapour Pressur |
0.000328mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
