| product Name |
2-Nitroacetanilide |
| Synonyms |
o-Nitroacetanilide; 2'-Nitroacetanilide; AI3-08843; NSC 1313; Acetamide, N-(2-nitrophenyl)-; Acetanilide, 2'-nitro- (8CI); N-(2-nitrophenyl)acetamide |
| Molecular Formula |
C8H8N2O3 |
| Molecular Weight |
180.1607 |
| InChI |
InChI=1/C8H8N2O3/c1-6(11)9-7-4-2-3-5-8(7)10(12)13/h2-5H,1H3,(H,9,11) |
| CAS Registry Number |
552-32-9 |
| EINECS |
209-009-6 |
| Molecular Structure |
|
| Density |
1.34g/cm3 |
| Melting point |
92-94℃ |
| Boiling point |
388.1°C at 760 mmHg |
| Refractive index |
1.617 |
| Flash point |
188.5°C |
| Vapour Pressur |
3.14E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
