product Name |
Perinaphthenone |
Synonyms |
phenalen-1-one; Perinaphthalenone; 1H-phenalen-1-one |
Molecular Formula |
C13H8O |
Molecular Weight |
180.202 |
InChI |
InChI=1/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
CAS Registry Number |
548-39-0 |
EINECS |
208-945-2 |
Molecular Structure |
|
Density |
1.265g/cm3 |
Melting point |
149-154℃ |
Boiling point |
355.2°C at 760 mmHg |
Refractive index |
1.715 |
Flash point |
157.9°C |
Vapour Pressur |
3.18E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|