| product Name |
Di-iso-pentylamine = Di-iso-amylamine |
| Synonyms |
Bis(3-methylbutyl)amine~Diisopentylamine; 3-methyl-N-(3-methylbutyl)butan-1-amine |
| Molecular Formula |
C10H23N |
| Molecular Weight |
157.2963 |
| InChI |
InChI=1/C10H23N/c1-9(2)5-7-11-8-6-10(3)4/h9-11H,5-8H2,1-4H3 |
| CAS Registry Number |
544-00-3 |
| EINECS |
208-856-9 |
| Molecular Structure |
|
| Density |
0.774g/cm3 |
| Boiling point |
188°C at 760 mmHg |
| Refractive index |
1.424 |
| Flash point |
46.6°C |
| Vapour Pressur |
0.613mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
