| product Name |
isobutyl formate |
| Synonyms |
Isobutyl methanoate; Tertyl formate; Formic acid isobutyl ester; 2-methylpropyl formate |
| Molecular Formula |
C5H10O2 |
| Molecular Weight |
102.1317 |
| InChI |
InChI=1/C5H10O2/c1-5(2)3-7-4-6/h4-5H,3H2,1-2H3 |
| CAS Registry Number |
542-55-2 |
| EINECS |
208-818-1 |
| Molecular Structure |
|
| Density |
0.887g/cm3 |
| Melting point |
-96℃ |
| Boiling point |
99.5°C at 760 mmHg |
| Refractive index |
1.386 |
| Flash point |
10°C |
| Vapour Pressur |
38.2mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24:Avoid contact with skin.;
S33:Take precautionary measures against static discharges.;
S9:Keep container in a well-ventilated place.;
|
