product Name |
DL-2-Aminoadipic acid hydrate |
Synonyms |
DL-2-aminoadipic acid monohydrate; DL-2-Aminoadipic acid; H-DL-2-Aad-OH~(+/-)-2-Aminohexanedioic acid; (2R)-2-aminohexanedioic acid; (2S)-2-ammoniohexanedioate; (2R)-2-ammoniohexanedioate |
Molecular Formula |
C6H10NO4 |
Molecular Weight |
160.1484 |
InChI |
InChI=1/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/p-1/t4-/m1/s1 |
CAS Registry Number |
542-32-5 |
EINECS |
208-809-2 |
Molecular Structure |
|
Melting point |
196-198℃ |
Boiling point |
364°C at 760 mmHg |
Flash point |
173.9°C |
Vapour Pressur |
2.74E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|