| product Name |
Acetoacetic Acid |
| Synonyms |
3-Oxobutanoic acid |
| Molecular Formula |
C4H6O3 |
| Molecular Weight |
102.0886 |
| InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| CAS Registry Number |
541-50-4 |
| Molecular Structure |
|
| Density |
1.182g/cm3 |
| Boiling point |
237.7°C at 760 mmHg |
| Refractive index |
1.427 |
| Flash point |
111.8°C |
| Vapour Pressur |
0.015mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
