| product Name |
p-tolylhydrazine |
| Synonyms |
4-Methylphenylhydrazine; (4-methylphenyl)hydrazine hydrochloride (1:1) |
| Molecular Formula |
C7H11ClN2 |
| Molecular Weight |
158.6286 |
| InChI |
InChI=1/C7H10N2.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,8H2,1H3;1H |
| CAS Registry Number |
539-44-6 |
| EINECS |
208-717-2 |
| Molecular Structure |
|
| Boiling point |
242.8°C at 760 mmHg |
| Flash point |
115.3°C |
| Vapour Pressur |
0.0333mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
