| product Name |
butyl cinnamate |
| Synonyms |
n-Butyl cinnamate, (Cinnamic acid n-butyl ester); Cinnamic acid n-butyl ester; n-Butyl cinnamate; butyl 3-phenylprop-2-enoate; butyl (2E)-3-phenylprop-2-enoate |
| Molecular Formula |
C13H16O2 |
| Molecular Weight |
204.2649 |
| InChI |
InChI=1/C13H16O2/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12/h4-10H,2-3,11H2,1H3/b10-9+ |
| CAS Registry Number |
538-65-8 |
| EINECS |
208-699-6 |
| Molecular Structure |
|
| Density |
1.021g/cm3 |
| Boiling point |
302.7°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
163.8°C |
| Vapour Pressur |
0.000974mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
