product Name |
4-Phenylsemicarbazide |
Synonyms |
Phenylsemicarbazide |
Molecular Formula |
C7H9N3O |
Molecular Weight |
151.16
|
InChI |
InChI=1/C7H9N3O/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
CAS Registry Number |
537-47-3 |
EINECS |
208-669-2 |
Molecular Structure |
|
Melting point |
122-127℃ |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|