| product Name |
N,N-Dimethyl-p-phenylenediamine dihydrochloride |
| Synonyms |
4-Amino-N,N-dimethylaniline dihydrochloride; 4-Dimethylaminoaniline dihydrochloride; N,N'-dimethylbenzene-1,4-diamine dihydrochloride |
| Molecular Formula |
C8H14Cl2N2 |
| Molecular Weight |
209.1162 |
| InChI |
InChI=1/C8H12N2.2ClH/c1-10(2)8-5-3-7(9)4-6-8;;/h3-6H,9H2,1-2H3;2*1H |
| CAS Registry Number |
536-46-9 |
| EINECS |
208-635-7 |
| Molecular Structure |
|
| Melting point |
222℃ |
| Boiling point |
262°C at 760 mmHg |
| Flash point |
88.6°C |
| Vapour Pressur |
0.0112mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|