| product Name |
L(+)-Erythrose |
| Molecular Formula |
C4H8O4 |
| Molecular Weight |
120.1039 |
| InChI |
InChI=1/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2/t3-,4+/m1/s1 |
| CAS Registry Number |
533-49-3 |
| EINECS |
208-567-8 |
| Molecular Structure |
|
| Density |
1.41g/cm3 |
| Melting point |
164℃ |
| Boiling point |
311.1°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
156.2°C |
| Vapour Pressur |
5.12E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
