| product Name |
thiocyanic acid, compound with quinoline (1:1) |
| Synonyms |
Quinoline rhodanide; Quinoline sulfocyanate; Quinolinium thiocyanate; Thiocyanic acid, compd. with quinoline; Isothiocyanic acid, compd. with quinoline (7CI); Quinoline, compd. with thiocyanate; Thiocyanic acid, compound with quinoline (1:1); quinoline thiocyanate (1:1) |
| Molecular Formula |
C10H8N2S |
| Molecular Weight |
188.2489 |
| InChI |
InChI=1/C9H7N.CHNS/c1-2-6-9-8(4-1)5-3-7-10-9;2-1-3/h1-7H;3H |
| CAS Registry Number |
530-65-4 |
| EINECS |
208-491-5 |
| Molecular Structure |
|
| Boiling point |
234.1°C at 760 mmHg |
| Flash point |
101.1°C |
| Vapour Pressur |
0.0822mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
