product Name |
4-Methylesculetin |
Synonyms |
6,7-Dihydroxy-4-methylcoumarin; 4-Methylesculetin, (6,7-Dihydroxy-4-methylcoumarin); 4-methylaesculetin; 6,7-dihydroxy-4-methyl-2H-chromen-2-one |
Molecular Formula |
C10H8O4 |
Molecular Weight |
192.1681 |
InChI |
InChI=1/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3 |
CAS Registry Number |
529-84-0 |
EINECS |
208-470-0 |
Molecular Structure |
|
Density |
1.456g/cm3 |
Melting point |
274-276℃ |
Boiling point |
455.5°C at 760 mmHg |
Refractive index |
1.651 |
Flash point |
190.7°C |
Vapour Pressur |
6.46E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|