| product Name |
5,6,7,8-Tetrahydro-1-naphthol |
| Synonyms |
5,6,7,8-Tetrahydro-alpha-naphthol; 5-Hydroxytetralin; NSC 28822; Tetrahydro-alpha-naphthol; 1-Naphthalenol, 5,6,7,8-tetrahydro- (9CI); 1-Naphthol, 5,6,7,8-tetrahydro- (8CI); 5,6,7,8-tetrahydronaphthalen-1-ol |
| Molecular Formula |
C10H12O |
| Molecular Weight |
148.2017 |
| InChI |
InChI=1/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7,11H,1-2,4,6H2 |
| CAS Registry Number |
529-35-1 |
| EINECS |
208-461-1 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Melting point |
67-71℃ |
| Boiling point |
268.2°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
122.6°C |
| Vapour Pressur |
0.00473mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
