| product Name |
2,6-Dimethylbenzoquinone |
| Molecular Formula |
C8H8O2 |
| Molecular Weight |
136.15 |
| InChI |
InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
| CAS Registry Number |
527-61-7 |
| EINECS |
208-420-8 |
| Molecular Structure |
|
| Melting point |
69-74℃ |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
