| product Name |
3,4,5-Trimethylphenol |
| Synonyms |
Phenol, 3,4,5-trimethyl-; 1-Hydroxy-3,4,5-trimethylbenzene; 3,4,5-Hemimellitenol; 5-Hydroxy-1,2,3-trimethylbenzene; NSC 65648 |
| Molecular Formula |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-6-4-9(10)5-7(2)8(6)3/h4-5,10H,1-3H3 |
| CAS Registry Number |
527-54-8 |
| EINECS |
208-418-7 |
| Molecular Structure |
|
| Density |
0.996g/cm3 |
| Melting point |
109-98℃ |
| Boiling point |
248.5°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
109.1°C |
| Vapour Pressur |
0.0153mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
