| product Name |
Tetrafluoro-p-benzoquinone |
| Synonyms |
Tetrafluoro-p-benzoquinone~Tetrafluoro-1,4-benzoquinone; p-Fluoranil; 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione |
| Molecular Formula |
C6F4O2 |
| Molecular Weight |
180.0566 |
| InChI |
InChI=1/C6F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
| CAS Registry Number |
527-21-9 |
| EINECS |
208-411-9 |
| Molecular Structure |
|
| Density |
1.62g/cm3 |
| Melting point |
183-186℃ |
| Boiling point |
133.1°C at 760 mmHg |
| Refractive index |
1.409 |
| Flash point |
44.6°C |
| Vapour Pressur |
8.61mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S37:Wear suitable gloves.;
|
|