| product Name |
Gluconic acid |
| Synonyms |
D-Gluconic acid solution; Gluconicacidaqsoln; D-Gluconic acid; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (non-preferred name); Gluconic Acid Solution |
| Molecular Formula |
C6H11O7 |
| Molecular Weight |
195.1479 |
| InChI |
InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1 |
| CAS Registry Number |
526-95-4 |
| EINECS |
208-401-4 |
| Molecular Structure |
|
| Melting point |
15℃ |
| Boiling point |
673.6°C at 760 mmHg |
| Flash point |
375.1°C |
| Vapour Pressur |
4.95E-21mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
