| product Name |
Flavone |
| Synonyms |
2-Phenyl-4H-1-benzopyran-4-one; 2-Phenylchromone; Flavone(2-Phenylchromone); 2-phenyl-4H-chromen-4-one |
| Molecular Formula |
C15H10O2 |
| Molecular Weight |
222.2387 |
| InChI |
InChI=1/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
| CAS Registry Number |
525-82-6 |
| EINECS |
208-383-8 |
| Molecular Structure |
|
| Density |
1.239g/cm3 |
| Melting point |
96-98℃ |
| Boiling point |
367°C at 760 mmHg |
| Refractive index |
1.635 |
| Flash point |
171.1°C |
| Vapour Pressur |
1.41E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
