| product Name |
5,6,7-Trimethoxyflavone |
| Synonyms |
Baicalein trimethyl ether; 5,6,7-trimethoxy-2-phenyl-4H-chromen-4-one |
| Molecular Formula |
C18H16O5 |
| Molecular Weight |
312.3166 |
| InChI |
InChI=1/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| CAS Registry Number |
973-67-1 |
| Molecular Structure |
|
| Density |
1.242g/cm3 |
| Melting point |
165-167℃ |
| Boiling point |
497.4°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
221.3°C |
| Vapour Pressur |
4.97E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|