| product Name |
4-hydroxy-1-methyl-3-phenyl-1,2-dihydroquinolin-2-one |
| Synonyms |
-; 2-hydroxy-1-methyl-3-phenylquinolin-4(1H)-one; 4-hydroxy-1-methyl-3-phenylquinolin-2(1H)-one |
| Molecular Formula |
C16H13NO2 |
| Molecular Weight |
251.2799 |
| InChI |
InChI=1/C16H13NO2/c1-17-13-10-6-5-9-12(13)15(18)14(16(17)19)11-7-3-2-4-8-11/h2-10,18H,1H3 |
| CAS Registry Number |
519-66-4 |
| Molecular Structure |
|
| Density |
1.293g/cm3 |
| Melting point |
225℃ |
| Boiling point |
403.67°C at 760 mmHg |
| Refractive index |
1.669 |
| Flash point |
197.933°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|