| product Name |
L(+)-Threoninol |
| Synonyms |
(2S,3S)-2-Amino-1,3-butanediol; (2R,3R)-2-aminobutane-1,3-diol |
| Molecular Formula |
C4H11NO2 |
| Molecular Weight |
105.1356 |
| InChI |
InChI=1/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m1/s1 |
| CAS Registry Number |
515-93-5 |
| Molecular Structure |
|
| Density |
1.118g/cm3 |
| Melting point |
54-57℃ |
| Boiling point |
257.8°C at 760 mmHg |
| Refractive index |
1.488 |
| Flash point |
109.7°C |
| Vapour Pressur |
0.00212mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
