| product Name |
tetraiodoethylene |
| Synonyms |
diiodoform; tetraiodoethene |
| Molecular Formula |
C2I4 |
| Molecular Weight |
531.6393 |
| InChI |
InChI=1/C2I4/c3-1(4)2(5)6 |
| CAS Registry Number |
513-92-8 |
| EINECS |
208-176-2 |
| Molecular Structure |
|
| Density |
4.087g/cm3 |
| Melting point |
191-193℃ |
| Boiling point |
288.3°C at 760 mmHg |
| Refractive index |
1.952 |
| Flash point |
139.9°C |
| Vapour Pressur |
0.00409mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
