| product Name |
16-Hydroxyhexadecanoic acid |
| Synonyms |
Juniperic acid; 16-hydroxyhexadecanoate |
| Molecular Formula |
C16H31O3 |
| Molecular Weight |
271.4161 |
| InChI |
InChI=1/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19)/p-1 |
| CAS Registry Number |
506-13-8 |
| EINECS |
208-028-7 |
| Molecular Structure |
|
| Melting point |
95-99℃ |
| Boiling point |
414.4°C at 760 mmHg |
| Flash point |
218.6°C |
| Vapour Pressur |
1.34E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
