product Name |
16-Hydroxyhexadecanoic acid |
Synonyms |
Juniperic acid; 16-hydroxyhexadecanoate |
Molecular Formula |
C16H31O3 |
Molecular Weight |
271.4161 |
InChI |
InChI=1/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19)/p-1 |
CAS Registry Number |
506-13-8 |
EINECS |
208-028-7 |
Molecular Structure |
|
Melting point |
95-99℃ |
Boiling point |
414.4°C at 760 mmHg |
Flash point |
218.6°C |
Vapour Pressur |
1.34E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|