product Name |
phorone |
Synonyms |
Phorone, (2,6-Dimethyl-2,5-heptadien-4-one); 2,6-Dimethyl-2,5-heptadien-4-one; Diisopropyllideneacetone; 2,6-dimethylhepta-2,5-dien-4-one |
Molecular Formula |
C9H14O |
Molecular Weight |
138.2069 |
InChI |
InChI=1/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
CAS Registry Number |
504-20-1 |
EINECS |
207-986-3 |
Molecular Structure |
|
Density |
0.858g/cm3 |
Melting point |
23-26℃ |
Boiling point |
198.5°C at 760 mmHg |
Refractive index |
1.453 |
Flash point |
79.4°C |
Vapour Pressur |
0.358mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|