product Name |
2,4-Diamino-s-triazine |
Synonyms |
Diaminotriazine; 1,3,5-triazine-2,4-diamine |
Molecular Formula |
C3H5N5 |
Molecular Weight |
111.1053 |
InChI |
InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
CAS Registry Number |
504-08-5 |
EINECS |
207-983-7 |
Molecular Structure |
|
Density |
1.508g/cm3 |
Boiling point |
447.6°C at 760 mmHg |
Refractive index |
1.716 |
Flash point |
254.9°C |
Vapour Pressur |
3.32E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|