product Name |
Adenosine |
Synonyms |
adenosine free base; 6-Amino-9-(beta-D-ribofuranosyl)9H-purine; 9-alpha-D-lyxofuranosyl-9H-purin-6-amine |
Molecular Formula |
C10H13N5O4 |
Molecular Weight |
267.2413 |
InChI |
InChI=1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6+,7+,10+/m1/s1 |
CAS Registry Number |
58-61-7 |
EINECS |
200-389-9 |
Molecular Structure |
|
Density |
2.08g/cm3 |
Melting point |
234-236℃ |
Boiling point |
676.3°C at 760 mmHg |
Refractive index |
1.907 |
Flash point |
362.8°C |
Vapour Pressur |
3.26E-19mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|