| product Name |
Adenosine |
| Synonyms |
adenosine free base; 6-Amino-9-(beta-D-ribofuranosyl)9H-purine; 9-alpha-D-lyxofuranosyl-9H-purin-6-amine |
| Molecular Formula |
C10H13N5O4 |
| Molecular Weight |
267.2413 |
| InChI |
InChI=1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6+,7+,10+/m1/s1 |
| CAS Registry Number |
58-61-7 |
| EINECS |
200-389-9 |
| Molecular Structure |
|
| Density |
2.08g/cm3 |
| Melting point |
234-236℃ |
| Boiling point |
676.3°C at 760 mmHg |
| Refractive index |
1.907 |
| Flash point |
362.8°C |
| Vapour Pressur |
3.26E-19mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
