| product Name |
1,2-Benzanthracene |
| Synonyms |
1,2-benzanthrene; 2,3-benzophenanthracene; 2,3-benzophenanthrene; B(A)A; benz[a]anthracene; Benz[a]anthracene? Benzanthracene; benzanthrene; Benzo[a]anthracene; Benzo[b]phenanthrene; naphthanthracene; tetraphene |
| Molecular Formula |
C18H12 |
| Molecular Weight |
228.2879 |
| InChI |
InChI=1/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H |
| CAS Registry Number |
56-55-3 |
| EINECS |
200-280-6 |
| Molecular Structure |
|
| Density |
1.19g/cm3 |
| Melting point |
158-161℃ |
| Boiling point |
436.7°C at 760 mmHg |
| Refractive index |
1.771 |
| Flash point |
209.1°C |
| Water solubility |
0.0000014 g/100 mL |
| Vapour Pressur |
2.02E-07mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
 N:Dangerous for the environment;
|
| Risk Codes |
R45:May cause cancer.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Safety Description |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
