| product Name |
4-Dimethylamino-2-methylazobenzene |
| Synonyms |
N,N-Dimethyl-4-phenylazo-m-toluidine; N,N,3-trimethyl-4-[(E)-phenyldiazenyl]aniline |
| Molecular Formula |
C15H17N3 |
| Molecular Weight |
239.3156 |
| InChI |
InChI=1/C15H17N3/c1-12-11-14(18(2)3)9-10-15(12)17-16-13-7-5-4-6-8-13/h4-11H,1-3H3/b17-16+ |
| CAS Registry Number |
54-88-6 |
| EINECS |
200-217-2 |
| Molecular Structure |
|
| Density |
1.01g/cm3 |
| Melting point |
65-68℃ |
| Boiling point |
390.9°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
190.2°C |
| Vapour Pressur |
2.57E-06mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R23/24:Toxic by inhalation and in contact with skin.;
R33:Danger of cummulative effects.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|