| product Name |
2-Acetamidofluorene |
| Synonyms |
N-(2-Fluorenyl)acetamide; Acetamidofluorene; N-(9H-fluoren-2-yl)acetamide; 2-(9H-fluoren-2-yl)acetamide |
| Molecular Formula |
C15H13NO |
| Molecular Weight |
223.2698 |
| InChI |
InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
| CAS Registry Number |
53-96-3 |
| EINECS |
200-188-6 |
| Molecular Structure |
|
| Density |
1.227g/cm3 |
| Melting point |
192-196℃ |
| Boiling point |
471.2°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
238.8°C |
| Water solubility |
0.000529 g/100 mL |
| Vapour Pressur |
4.73E-09mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R46:May cause heritable genetic damages.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
