product Name |
L-Thyroxine |
Synonyms |
levothyroxine; 3-[4-(4-Hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-alanine; 3,5,3’,5’-tetraiodothyronine; beta-[(3,5-diiodo-4-hydroxyphenoxy)-3,5-diiodophenyl]alanine; l-3,5,3’,5’-tetraiodothyronine; l-t4; o-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-l-tyrosin; o-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine; t4(hormone); tetraiodothyronine; O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine |
Molecular Formula |
C15H11I4NO4 |
Molecular Weight |
776.87 |
InChI |
InChI=1/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 |
CAS Registry Number |
51-48-9 |
EINECS |
200-101-1 |
Molecular Structure |
|
Density |
2.635g/cm3 |
Melting point |
223℃ (dec.) |
Boiling point |
576.3°C at 760 mmHg |
Refractive index |
1.795 |
Flash point |
302.3°C |
Water solubility |
insoluble |
Vapour Pressur |
4.02E-14mmHg at 25°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S24/25:;
|
|