product Name |
6-(Methylthio)purine |
Synonyms |
6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
Molecular Formula |
C6H6N4S |
Molecular Weight |
166.2036 |
InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
CAS Registry Number |
50-66-8 |
EINECS |
200-057-3 |
Molecular Structure |
|
Density |
1.59g/cm3 |
Melting point |
221-222℃ |
Boiling point |
290.9°C at 760 mmHg |
Refractive index |
1.806 |
Flash point |
129.7°C |
Vapour Pressur |
0.00351mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|