| product Name |
4-hydroxy-3,5-diiodobenzoic acid |
| Synonyms |
3,5-Diiodo-4-hydroxybenzoic acid |
| Molecular Formula |
C7H4I2O3 |
| Molecular Weight |
389.9138 |
| InChI |
InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| CAS Registry Number |
618-76-8 |
| EINECS |
210-562-0 |
| Molecular Structure |
|
| Density |
2.697g/cm3 |
| Boiling point |
346.4°C at 760 mmHg |
| Refractive index |
1.784 |
| Flash point |
163.3°C |
| Vapour Pressur |
2.19E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
