| product Name |
Ethyl oxamate |
| Synonyms |
oxamethane; Oxamic acid ethyl ester; ethyl amino(oxo)acetate |
| Molecular Formula |
C4H7NO3 |
| Molecular Weight |
117.1033 |
| InChI |
InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
| CAS Registry Number |
617-36-7 |
| EINECS |
210-512-8 |
| Molecular Structure |
|
| Density |
1.184g/cm3 |
| Melting point |
112-115℃ |
| Boiling point |
188.7°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
87°C |
| Vapour Pressur |
0.59mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
