| product Name |
o-Tolyl benzoate |
| Synonyms |
o-Tolyl benzoate (Benzoic acid o-tolyl ester); Benzoic acid o-tolyl ester; 2-methylphenyl benzoate |
| Molecular Formula |
C14H12O2 |
| Molecular Weight |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
| CAS Registry Number |
617-02-7 |
| EINECS |
210-501-8 |
| Molecular Structure |
|
| Density |
1.122g/cm3 |
| Boiling point |
368.9°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
154.5°C |
| Vapour Pressur |
1.23E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
