product Name |
1,2-Dichlorobutane |
Synonyms |
Butane, 1,2-dichloro-; HSDB 5717; NSC 93880 |
Molecular Formula |
C4H8Cl2 |
Molecular Weight |
127.0123 |
InChI |
InChI=1/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
CAS Registry Number |
616-21-7 |
EINECS |
210-469-5 |
Molecular Structure |
|
Density |
1.079g/cm3 |
Boiling point |
122.8°C at 760 mmHg |
Refractive index |
1.427 |
Flash point |
27.4°C |
Vapour Pressur |
16.5mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R10:Flammable.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|